CAS 92352-27-7

4-(5-Amino-1H-1,2,4-triazol-3-yl)phenol

Description:

4-(5-Amino-1H-1,2,4-triazol-3-yl)phenol, with the CAS number 92352-27-7, is an organic compound characterized by its triazole and phenolic functional groups. This substance typically appears as a solid and is soluble in polar solvents, reflecting its ability to engage in hydrogen bonding due to the presence of both amino and hydroxyl groups. The triazole ring contributes to its potential biological activity, making it of interest in pharmaceutical research, particularly in the development of antifungal and antimicrobial agents. The compound's structure allows for various chemical modifications, which can enhance its efficacy or alter its properties for specific applications. Additionally, it may exhibit properties such as antioxidant activity due to the phenolic component. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken. Overall, 4-(5-Amino-1H-1,2,4-triazol-3-yl)phenol represents a versatile compound with potential applications in medicinal chemistry and related fields.

Formula: C₈H₈N₄O

InChI: InChI=1S/C8H8N4O/c9-8-10-7(11-12-8)5-1-3-6(13)4-2-5/h1-4,13H,(H3,9,10,11,12)

InChI key: InChIKey=NBQBFWFMBWJWFX-UHFFFAOYSA-N

SMILES: NC=1NC(C2=CC=C(O)C=C2)=NN1

Synonyms:

• Phenol, p-(5-amino-s-triazol-3-yl)-
• Phenol, 4-(5-amino-1H-1,2,4-triazol-3-yl)-
• 4-(5-Amino-1H-1,2,4-triazol-3-yl)phenol

4-(5-Amino-1H-1,2,4-triazol-3-yl)phenol

CAS: 92352-27-7

Versatile small molecule scaffold

Formula: C₈H₈N₄O

Purity: Min. 95%

Molecular weight: 176.18 g/mol

Ref: 3D-SDA35227