CAS 92352-29-9
:5-pyridin-2-yl-1H-pyrazol-3-amine
Description:
5-Pyridin-2-yl-1H-pyrazol-3-amine is a chemical compound characterized by its unique structure, which includes a pyrazole ring and a pyridine moiety. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and the ability to participate in various chemical reactions. It is often studied for its potential applications in medicinal chemistry, particularly as a scaffold for drug development due to its ability to interact with biological targets. The presence of both the pyrazole and pyridine rings may contribute to its solubility and reactivity, making it a candidate for further research in pharmacology and material science. Additionally, the compound's CAS number, 92352-29-9, allows for easy identification and retrieval of information in chemical databases. Overall, 5-pyridin-2-yl-1H-pyrazol-3-amine represents a versatile structure with potential implications in various fields of chemistry and biochemistry.
Formula:C8H8N4
InChI:InChI=1/C8H8N4/c9-8-5-7(11-12-8)6-3-1-2-4-10-6/h1-5H,(H3,9,11,12)
SMILES:c1ccnc(c1)c1cc(=N)[nH][nH]1
Synonyms:- 1H-pyrazol-3-amine, 5-(2-pyridinyl)-
- 1H-pyrazol-5-amine, 3-(2-pyridinyl)-
- 3-(pyridin-2-yl)-1H-pyrazol-5-amine
- 5-(2-Pyridinyl)-1H-pyrazol-3-amine
- 5-(Pyridin-2-yl)-1H-pyrazol-3-amin
- 5-Pyridin-2-yl-2H-pyrazol-3-ylamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-Pyridin-2-yl-2H-pyrazol-3-ylamine
CAS:Formula:C8H8N4Purity:95%Color and Shape:SolidMolecular weight:160.17595-Pyridin-2-yl-2H-pyrazol-3-ylamine
CAS:<p>5-Pyridin-2-yl-2H-pyrazol-3-ylamine</p>Molecular weight:160.18g/mol5-Pyridin-2-yl-2H-pyrazol-3-ylamine
CAS:Formula:C8H8N4Purity:95%Color and Shape:SolidMolecular weight:160.185-Pyridin-2-yl-2H-pyrazol-3-ylamine
CAS:<p>5-Pyridin-2-yl-2H-pyrazol-3-ylamine is a chemical intermediate that can be used in the synthesis of many different compounds. This compound is a versatile building block that can be used to make complex substances, as well as being an excellent reagent for research purposes. It has been shown to be useful as a reactant in the preparation of high quality chemicals and speciality chemicals. 5-Pyridin-2-yl-2H-pyrazol-3-ylamine is a fine chemical with CAS No. 92352-29-9.</p>Formula:C8H8N4Purity:Min. 95%Color and Shape:Off-White Or Light Brown SolidMolecular weight:160.18 g/mol



