CAS 923565-22-4

Ethanone, 1-[4-[(3-fluorophenyl)amino]-1-piperidinyl]-2-[4-[[(3S)-3-methyl-1-piperazinyl]methyl]phenyl]-, hydrochloride (1:1)

Description:

Ethanone, 1-[4-[(3-fluorophenyl)amino]-1-piperidinyl]-2-[4-[[(3S)-3-methyl-1-piperazinyl]methyl]phenyl]-, hydrochloride (1:1), with CAS number 923565-22-4, is a synthetic organic compound characterized by its complex molecular structure, which includes multiple aromatic rings and piperidine and piperazine moieties. This compound is typically categorized as a pharmaceutical agent, potentially exhibiting properties relevant to the treatment of various medical conditions. Its hydrochloride salt form enhances solubility in aqueous solutions, making it suitable for formulation in drug development. The presence of fluorine in the structure may influence its pharmacokinetic properties, such as metabolic stability and receptor binding affinity. Additionally, the compound's intricate arrangement of functional groups suggests potential interactions with biological targets, which could be explored in medicinal chemistry research. As with many synthetic compounds, safety and toxicity profiles would need to be evaluated through rigorous testing to determine its suitability for therapeutic use.

Formula: C₂₅H₃₃FN₄O·ClH

InChI: InChI=1S/C25H33FN4O.ClH/c1-19-17-29(14-11-27-19)18-21-7-5-20(6-8-21)15-25(31)30-12-9-23(10-13-30)28-24-4-2-3-22(26)16-24;/h2-8,16,19,23,27-28H,9-15,17-18H2,1H3;1H/t19-;/m0./s1

InChI key: InChIKey=MZEVMNJFEUATKJ-FYZYNONXSA-N

SMILES: C(CC1=CC=C(CN2C[C@H](C)NCC2)C=C1)(=O)N3CCC(NC4=CC(F)=CC=C4)CC3.Cl

Synonyms:

• Ethanone, 1-[4-[(3-fluorophenyl)amino]-1-piperidinyl]-2-[4-[[(3S)-3-methyl-1-piperazinyl]methyl]phenyl]-, hydrochloride (1:1)

Camicinal Hydrochloride

Controlled Product

CAS: 923565-22-4

Formula: C₂₅H₃₃FN₄O•HCl

Color and Shape: Neat

Molecular weight: 424.55 + (36.46)

Ref: TR-C923560

GSK962040 hydrochloride

CAS: 923565-22-4

GSK962040 hydrochloride is a selective sodium channel blocker, which is derived from synthetic chemical processes involving precise organic synthesis methods. This compound operates by selectively inhibiting specific sodium channel subtypes, thereby altering the electrophysiological properties of neuronal and muscle tissues. The mode of action involves blocking the influx of sodium ions through voltage-gated sodium channels, which diminishes excitatory signaling and stabilizes nerve membranes.

Formula: C₂₅H₃₄ClFN₄O

Purity: Min. 95%

Molecular weight: 461 g/mol

Ref: 3D-YLB56522