CAS 923590-95-8
:1H-Isoindole, 4-bromo-2,3-dihydro-, hydrochloride (1:1)
Description:
1H-Isoindole, 4-bromo-2,3-dihydro-, hydrochloride (1:1) is a chemical compound characterized by its isoindole structure, which features a bicyclic framework consisting of a five-membered ring fused to a six-membered ring. The presence of a bromine atom at the 4-position introduces notable electrophilic properties, influencing its reactivity and potential applications in organic synthesis. As a hydrochloride salt, it is typically encountered in a stable, crystalline form, which enhances its solubility in polar solvents, making it suitable for various chemical reactions and biological studies. This compound may exhibit biological activity, potentially serving as a precursor or intermediate in the synthesis of pharmaceuticals or agrochemicals. Its molecular interactions can be influenced by the bromine substituent, which may affect its binding affinity in biological systems. Safety data should be consulted for handling, as halogenated compounds can pose specific hazards. Overall, 1H-Isoindole, 4-bromo-2,3-dihydro-, hydrochloride is a versatile compound with applications in medicinal chemistry and research.
Formula:C8H8BrN·ClH
InChI:InChI=1S/C8H8BrN.ClH/c9-8-3-1-2-6-4-10-5-7(6)8;/h1-3,10H,4-5H2;1H
InChI key:InChIKey=FQHLHVFOJBANKY-UHFFFAOYSA-N
SMILES:BrC1=C2C(=CC=C1)CNC2.Cl
Synonyms:- 1H-Isoindole, 4-bromo-2,3-dihydro-, hydrochloride (1:1)
- 3-Bromo-1H-isoindoline Hydrochloride
- 4-Bromo-2,3-Dihydro-1H-Isoindole Hydrochloride
- 4-Bromo-Isoindoline Hcl
- 4-Bromoisoindoline hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Bromoisoindoline, HCl
CAS:Formula:C8H9BrClNPurity:97%Color and Shape:SolidMolecular weight:234.5208Ref: IN-DA0033YI
1g37.00€5g91.00€10g137.00€1kgTo inquire25g201.00€50g336.00€100g558.00€500gTo inquire100mg26.00€250mg28.00€4-Bromoisoindoline Hydrochloride
CAS:4-Bromoisoindoline HydrochlorideFormula:C8H8BrN·ClHPurity:95%Color and Shape: white to off-white solidMolecular weight:234.52g/mol4-Bromo-isoindoline hydrochloride
CAS:Formula:C8H9BrClNPurity:97%Color and Shape:SolidMolecular weight:234.524-Bromoisoindoline hydrochloride
CAS:4-Bromoisoindoline hydrochloride (BII) is a chemical compound that can be used as a building block for making other chemicals. It can also be used to make research chemicals or as a reaction component in the synthesis of other compounds. It has been shown to be an effective reagent and is useful for the production of fine chemicals with high purity.
Formula:C8H9BrClNPurity:Min. 95%Color and Shape:PowderMolecular weight:234.52 g/mol



