CymitQuimica logo

CAS 923595-49-7

:

6-CHLORO-3-IODOIMIDAZO[1,2-B]PYRIDAZINE

Description:
6-Chloro-3-iodoimidazo[1,2-b]pyridazine is a heterocyclic compound characterized by its imidazo and pyridazine rings, which contribute to its unique chemical properties. The presence of chlorine and iodine substituents enhances its reactivity and potential biological activity. This compound typically exhibits a solid state at room temperature and may have specific solubility characteristics depending on the solvent used. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of halogen atoms that can influence biological interactions. Additionally, the imidazo and pyridazine moieties are known for their roles in various biological activities, making this compound of interest in drug discovery. The compound's CAS number, 923595-49-7, allows for easy identification and retrieval of data related to its synthesis, properties, and potential applications in scientific literature. Overall, 6-chloro-3-iodoimidazo[1,2-b]pyridazine represents a valuable compound for research in organic and medicinal chemistry.
Formula:C6H3ClIN3
InChI:InChI=1S/C6H3ClIN3/c7-4-1-2-6-9-3-5(8)11(6)10-4/h1-3H
InChI key:IWHCPHZAMFSDFM-UHFFFAOYSA-N
SMILES:C1=CC(=NN2C1=NC=C2I)Cl
Found 5 products.