CAS 92369-80-7

Naphthalene, 1-butyldecahydro-

Description:

Naphthalene, 1-butyldecahydro- is an organic compound characterized by its structure, which includes a naphthalene ring substituted with a butyl group and a saturated hydrocarbon chain. This compound is part of a larger class of polycyclic aromatic hydrocarbons (PAHs) and is typically colorless to pale yellow in appearance. It is known for its aromatic properties and may exhibit a distinct odor reminiscent of mothballs, similar to naphthalene itself. The presence of the butyl group influences its solubility and volatility, making it less volatile than unsubstituted naphthalene. Naphthalene derivatives like this one are often used in various industrial applications, including as intermediates in the synthesis of dyes, fragrances, and other organic compounds. Additionally, its physical properties, such as melting and boiling points, can vary based on the specific structure and substituents. Safety considerations are important, as many naphthalene derivatives can be toxic or harmful to the environment, necessitating proper handling and disposal measures.

Formula: C₁₄H₂₆

InChI: InChI=1/C14H26/c1-2-3-7-12-9-6-10-13-8-4-5-11-14(12)13/h12-14H,2-11H2,1H3

SMILES: CCCCC1CCCC2CCCCC12

Synonyms:

• alpha-n-Butyldecalin
• 1-Butyldecahydro-naphthalene

Naphthalene,1-butyldecahydro-

CAS: 92369-80-7

Formula: C₁₄H₂₆

Purity: 98%

Molecular weight: 194.3562

Ref: IN-DA00GUK8

1-Butyl-decahydronaphthalene

CAS: 92369-80-7

1-Butyl-decahydronaphthalene

Purity: 98%

Molecular weight: 194.36g/mol

Ref: 54-OR1005277

1-Butyl-decahydronaphthalene

CAS: 92369-80-7

Purity: 95.0%

Color and Shape: Liquid

Molecular weight: 194.36199951171875

Ref: 10-F092157