CAS 923716-19-2

2,5-Dimethyl-1-[3-(methylthio)phenyl]-1H-pyrrole-3-carboxaldehyde

Description:

2,5-Dimethyl-1-[3-(methylthio)phenyl]-1H-pyrrole-3-carboxaldehyde is an organic compound characterized by its complex structure, which includes a pyrrole ring, a carboxaldehyde functional group, and a methylthio-substituted phenyl group. This compound typically exhibits a range of chemical properties due to the presence of multiple functional groups. The pyrrole ring contributes to its aromaticity and potential reactivity, while the carboxaldehyde group can participate in various chemical reactions, such as nucleophilic addition and condensation. The methylthio group enhances the compound's solubility in organic solvents and may influence its electronic properties. In terms of physical characteristics, compounds of this nature often have moderate to high melting points and may be soluble in polar and non-polar solvents, depending on their specific substituents. Additionally, this compound may exhibit biological activity, making it of interest in pharmaceutical research. However, detailed studies would be necessary to fully understand its reactivity, stability, and potential applications in various fields.

Formula: C₁₄H₁₅NOS

InChI: InChI=1S/C14H15NOS/c1-10-7-12(9-16)11(2)15(10)13-5-4-6-14(8-13)17-3/h4-9H,1-3H3

InChI key: InChIKey=JWVSAYKXOKYWFR-UHFFFAOYSA-N

SMILES: CC=1N(C2=CC(SC)=CC=C2)C(C)=CC1C=O

Synonyms:

• 1H-Pyrrole-3-carboxaldehyde, 2,5-dimethyl-1-[3-(methylthio)phenyl]-
• 2,5-Dimethyl-1-[3-(methylthio)phenyl]-1H-pyrrole-3-carboxaldehyde