CAS 923772-93-4
:3-chloro-4-methyl-1-benzothiophene-2-carboxylic acid
Description:
3-Chloro-4-methyl-1-benzothiophene-2-carboxylic acid is a heterocyclic organic compound characterized by its benzothiophene structure, which incorporates a thiophene ring fused to a benzene ring. The presence of a carboxylic acid functional group (-COOH) at the 2-position contributes to its acidity and reactivity, making it a potential candidate for various chemical reactions, including esterification and amidation. The chlorine atom at the 3-position and the methyl group at the 4-position introduce specific steric and electronic effects, influencing the compound's reactivity and solubility. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its unique structure allows for potential applications in materials science and organic synthesis. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample. Safety data should be consulted for handling and storage, as halogenated compounds can pose health risks.
Formula:C10H7ClO2S
InChI:InChI=1/C10H7ClO2S/c1-5-3-2-4-6-7(5)8(11)9(14-6)10(12)13/h2-4H,1H3,(H,12,13)
SMILES:Cc1cccc2c1c(c(C(=O)O)s2)Cl
Synonyms:- 3-Chloro-4-methylbenzo[b]thiophene-2-carboxylicacid
- Benzo[B]Thiophene-2-Carboxylic Acid, 3-Chloro-4-Methyl-
- 3-Chloro-4-methyl-1-benzothiophene-2-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
