CAS 92385-37-0
:5-Chloro-4-quinolinamine
Description:
5-Chloro-4-quinolinamine is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a chlorine atom at the 5-position and an amino group at the 4-position contributes to its unique chemical properties. This compound typically appears as a solid and is soluble in organic solvents, with limited solubility in water due to its aromatic nature. It may exhibit biological activity, making it of interest in medicinal chemistry and drug development. The amino group can participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. Additionally, the chlorine substituent can affect the compound's electronic properties, potentially enhancing its reactivity in electrophilic substitution reactions. Safety data sheets should be consulted for handling precautions, as with many chemical substances, it may pose health risks if not managed properly. Overall, 5-Chloro-4-quinolinamine serves as a valuable compound in various chemical research applications.
Formula:C9H7ClN2
InChI:InChI=1S/C9H7ClN2/c10-6-2-1-3-8-9(6)7(11)4-5-12-8/h1-5H,(H2,11,12)
InChI key:InChIKey=JQZNHGOMVIJEAJ-UHFFFAOYSA-N
SMILES:NC=1C2=C(C=CC=C2Cl)N=CC1
Synonyms:- 4-Quinolinamine, 5-chloro-
- 5-Chloro-4-quinolinamine
- 5-Chloro-Quinolin-4-Ylamine
- Quinoline, 4-amino-5-chloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
