CAS 923929-10-6

5-Bromo-4-methyl-N-nitropyridine-2-amine

Description:

5-Bromo-4-methyl-N-nitropyridine-2-amine is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 5-position and a methyl group at the 4-position contributes to its unique reactivity and physical properties. Additionally, the nitro group at the N-position enhances its electrophilic character, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its solubility and stability can vary depending on the solvent and environmental conditions. Safety data should be consulted, as the presence of bromine and nitro groups may pose hazards, including toxicity and environmental concerns. Overall, 5-Bromo-4-methyl-N-nitropyridine-2-amine is a versatile compound with applications in synthetic chemistry and material science.

Formula: C₆H₆BrN₃O₂

InChI: InChI=1/C6H6BrN3O2/c1-4-2-6(9-10(11)12)8-3-5(4)7/h2-3H,1H3,(H,8,9)

SMILES: Cc1cc(ncc1Br)NN(=O)=O

Synonyms:

• 2-pyridinamine, 5-bromo-4-methyl-N-nitro-
• 5-Brom-4-methyl-N-nitropyridin-2-amin
• 5-Bromo-4-methyl-N-nitropyridin-2-amine