
CAS 923947-66-4
:5-Methyl-2-(2-oxazolyl)benzenamine
Description:
5-Methyl-2-(2-oxazolyl)benzenamine, identified by its CAS number 923947-66-4, is an organic compound characterized by its aromatic structure, which includes a methyl group and an oxazole ring. This compound features a benzene ring substituted with an amino group and an oxazole moiety, contributing to its potential biological activity. The presence of the oxazole ring, a five-membered heterocyclic compound containing nitrogen and oxygen, may impart unique chemical properties, including the ability to participate in various chemical reactions and interactions. The amino group enhances its solubility in polar solvents and may facilitate hydrogen bonding, making it relevant in medicinal chemistry and material science. Additionally, the methyl substitution can influence the compound's electronic properties and steric hindrance, affecting its reactivity and interaction with biological targets. Overall, 5-Methyl-2-(2-oxazolyl)benzenamine is of interest for its potential applications in pharmaceuticals and as a building block in organic synthesis.
Formula:C10H10N2O
InChI:InChI=1S/C10H10N2O/c1-7-2-3-8(9(11)6-7)10-12-4-5-13-10/h2-6H,11H2,1H3
InChI key:InChIKey=WLWOLFIKXRFLBF-UHFFFAOYSA-N
SMILES:NC1=C(C2=NC=CO2)C=CC(C)=C1
Synonyms:- Benzenamine, 5-methyl-2-(2-oxazolyl)-
- 5-Methyl-2-(2-oxazolyl)benzenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.