CAS 92396-88-8
:bis(trihexylsiloxy)silicon 2,3-naph-thalocyanine
Description:
Bis(trihexylsiloxy)silicon 2,3-naphthalocyanine is a complex organic compound known for its unique structural and electronic properties. It features a silicon atom coordinated with a naphthalocyanine moiety, which is a type of macrocyclic compound that exhibits strong light-absorbing characteristics, making it useful in various applications such as dyes, pigments, and photonic devices. The presence of trihexylsiloxy groups enhances its solubility in organic solvents, facilitating its use in solution-based processes. This compound typically exhibits strong UV-Vis absorption due to its conjugated system, which allows for efficient light harvesting. Additionally, its stability and thermal resistance make it suitable for applications in organic electronics and photovoltaics. The molecular structure contributes to its potential as a photosensitizer in photochemical reactions. Overall, bis(trihexylsiloxy)silicon 2,3-naphthalocyanine is notable for its versatility and effectiveness in various chemical and material science applications.
Formula:C84H102N8O2Si3
InChI:InChI=1/C48H24N8.2C18H39OSi.Si/c1-2-10-26-18-34-33(17-25(26)9-1)41-49-42(34)54-44-37-21-29-13-5-6-14-30(29)22-38(37)46(51-44)56-48-40-24-32-16-8-7-15-31(32)23-39(40)47(52-48)55-45-36-20-28-12-4-3-11-27(28)19-35(36)43(50-45)53-41;2*1-4-7-10-13-16-20(19,17-14-11-8-5-2)18-15-12-9-6-3;/h1-24H;2*4-18H2,1-3H3;/q-2;2*-1;+4
SMILES:c1ccc2cc3c(cc2c1)C1=NC3=NC2=NC(=Nc3c4cc5ccccc5cc4c([n-]3)N=C3c4cc5ccccc5cc4C(=N3)[N-]1)c1cc3ccccc3cc21.CCCCCC[Si](CCCCCC)(CCCCCC)[O-].CCCCCC[Si](CCCCCC)(CCCCCC)[O-].[SiH4]
Synonyms:- Bis(trihexylsiloxy)silicon 2,3-naphthalocyanine
- Silicon 2,3-naphthalocyanine bis(trihexylsilyloxide)
- silicon(4+) (1Z,14Z,41Z)-2,15,28,41,53,54,55,56-octaazatridecacyclo[40.10.1.1~3,14~.1~16,27~.1~29,40~.0~4,13~.0~6,11~.0~17,26~.0~19,24~.0~30,39~.0~32,37~.0~43,52~.0~45,50~]hexapentaconta-1,3(56),4,6,8,10,12,14,16(55),17,19,21,23,25,27,29,31,33,35,37,39,41,43,45,47,49,51-heptacosaene-53,54-diide trihexylsilanolate (1:1:2) (non-preferred name)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Silicon 2,3-Naphthalocyanine Bis(trihexylsilyloxide)
CAS:Formula:C84H102N8O2Si3Color and Shape:NeatMolecular weight:1340.018Silicon 2,3-naphthalocyanine bis(trihexylsilyloxide)
CAS:<p>Silicon 2,3-naphthalocyanine bis(trihexylsilyloxide) is a luminescent probe that is used as an optical imaging agent for tumor tissue. It has been shown to be effective for determining the area of tumor tissue and for monitoring the efficacy of cancer treatments in animal models. Silicon 2,3-naphthalocyanine bis(trihexylsilyloxide) has also been used to monitor the progression of liver cancer in animals by measuring tumor vasculature and fluorescence resonance. This molecule is reactive with deionized water, which makes it a good candidate for use as an imaging agent in biological studies. Silicon 2,3-naphthalocyanine bis(trihexylsilyloxide) reacts with oxygen at a rate that is dependent on its concentration. This reaction can be used to measure reaction rates in vitro.</p>Formula:C84H102N8O2Si3Purity:Min. 95%Color and Shape:PowderMolecular weight:1,340.02 g/mol

