CAS 92398-47-5
:Cyclobutanecarboxylicacid, 1-amino-, methyl ester, hydrochloride (1:1)
Description:
Cyclobutanecarboxylic acid, 1-amino-, methyl ester, hydrochloride (1:1) is a chemical compound characterized by its cyclobutane ring structure, which contributes to its unique properties. As a carboxylic acid derivative, it contains both an amino group and a methyl ester functional group, making it a versatile molecule in organic synthesis. The hydrochloride form indicates that the compound is a salt, which enhances its solubility in water and may influence its biological activity. Typically, compounds of this nature are studied for their potential applications in pharmaceuticals, particularly as intermediates in the synthesis of biologically active molecules. The presence of the amino group suggests potential for interactions with biological targets, while the cyclobutane ring may impart specific steric and electronic properties. Overall, this compound's characteristics, including its molecular structure and functional groups, make it of interest in various fields, including medicinal chemistry and materials science.
Formula:C6H12ClNO2
InChI:InChI=1/C6H11NO2.ClH/c1-9-5(8)6(7)3-2-4-6;/h2-4,7H2,1H3;1H
SMILES:COC(=O)C1(CCC1)N.Cl
Synonyms:- Methyl 1-Aminocyclobutanecarboxylate Hydrochloride
- Cyclobutanecarboxylicacid, 1-amino-, methyl ester, hydrochloride
- 1-Aminocyclobutanecarboxylicacid methyl ester hydrochloride
- Cyclobutanecarboxylic Acid, 1-Amino-, Methyl Ester Hydrochloride
- Methyl 1-Aminocyclobutane-1-Carboxylate Hydrochloride
- Methyl 1-aMinocyclobutane carboxylate HCl
- Cyclobutanecarboxylic acid, 1-amino-, methyl ester, hydrochloride (9CI)
- Methyl1-aminocyclobutanecarboxylatehydrochloride,95%
- 1-Aminocyclobutanecarboxylicacidmethylesterhydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Methyl 1-aminocyclobutanecarboxylate hydrochloride
CAS:Formula:C6H12ClNO2Purity:97%Color and Shape:SolidMolecular weight:165.6180Methyl 1-aminocyclobutanecarboxylate hydrochloride
CAS:Methyl 1-aminocyclobutanecarboxylate hydrochlorideFormula:C6H11NO2·ClHPurity:98%Color and Shape: white solidMolecular weight:165.62g/mol1-Amino-cyclobutanecarboxylic acid methyl ester hydrochloride
CAS:Formula:C6H12ClNO2Purity:97%Color and Shape:SolidMolecular weight:165.62


