CymitQuimica logo

CAS 92406-50-3

:

2-methyl-5-(2-pyridyl)pyrazol-3-amine

Description:
2-Methyl-5-(2-pyridyl)pyrazol-3-amine is a chemical compound characterized by its pyrazole ring structure, which is substituted with a methyl group and a pyridine moiety. This compound features a pyrazole core, a five-membered ring containing two nitrogen atoms, and is further functionalized with an amino group at the 3-position. The presence of the pyridine ring contributes to its potential as a ligand in coordination chemistry, as well as its biological activity. The compound may exhibit properties such as solubility in polar solvents, and its structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the presence of both nitrogen-containing heterocycles may influence its reactivity and stability under various conditions. Overall, 2-methyl-5-(2-pyridyl)pyrazol-3-amine is a versatile compound with applications in research and development, particularly in the fields of pharmaceuticals and agrochemicals.
Formula:C9H10N4
InChI:InChI=1/C9H10N4/c1-13-9(10)6-8(12-13)7-4-2-3-5-11-7/h2-6H,10H2,1H3
SMILES:Cn1c(cc(c2ccccn2)n1)N
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.