CymitQuimica logo

CAS 92406-51-4

:

3-(3-Furanyl)-1-methyl-1H-pyrazol-5-amine

Description:
3-(3-Furanyl)-1-methyl-1H-pyrazol-5-amine, with the CAS number 92406-51-4, is an organic compound characterized by its unique structural features, which include a pyrazole ring substituted with a methyl group and a furanyl group. The presence of the furanyl moiety contributes to its aromatic properties, potentially influencing its reactivity and interaction with biological systems. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amine functional group. The pyrazole ring is known for its diverse biological activities, making derivatives of this compound of interest in medicinal chemistry. Additionally, the compound may participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, due to the reactivity of the amine group. Its potential applications could span across pharmaceuticals, agrochemicals, or materials science, depending on the specific properties and activities demonstrated in further studies.
Formula:C8H9N3O
InChI:InChI=1S/C8H9N3O/c1-11-8(9)4-7(10-11)6-2-3-12-5-6/h2-5H,9H2,1H3
InChI key:InChIKey=WEDKTHSEWJJSHB-UHFFFAOYSA-N
SMILES:NC1=CC(=NN1C)C=2C=COC2
Synonyms:
  • 1H-Pyrazol-5-amine, 3-(3-furanyl)-1-methyl-
  • 3-(3-Furanyl)-1-methyl-1H-pyrazol-5-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.