CAS 92410-92-9

5-Propyl-2-pyridinamine

Description:

5-Propyl-2-pyridinamine, with the CAS number 92410-92-9, is an organic compound characterized by its pyridine ring structure substituted with an amino group and a propyl group. This compound features a six-membered aromatic ring containing one nitrogen atom, which contributes to its basicity and potential reactivity. The presence of the propyl group enhances its hydrophobic characteristics, influencing its solubility and interaction with biological systems. Typically, compounds like 5-propyl-2-pyridinamine may exhibit properties such as moderate to high melting and boiling points, depending on their molecular interactions. They can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making them valuable in synthetic organic chemistry and pharmaceutical applications. Additionally, the amino group can engage in hydrogen bonding, affecting the compound's behavior in solution and its potential biological activity. Overall, 5-propyl-2-pyridinamine is of interest in research and development, particularly in medicinal chemistry and material science.

Formula: C₈H₁₂N₂

InChI: InChI=1S/C8H12N2/c1-2-3-7-4-5-8(9)10-6-7/h4-6H,2-3H2,1H3,(H2,9,10)

InChI key: InChIKey=JYJJVSILRLLKGL-UHFFFAOYSA-N

SMILES: C(CC)C=1C=CC(N)=NC1

Synonyms:

• 5-Propyl-2-pyridinamine
• 2-Pyridinamine, 5-propyl-
• 2-Amino-5-propylpyridine