CAS 924271-34-1
:7-Bromo-6-methoxy-1(2H)-isoquinolinone
Description:
7-Bromo-6-methoxy-1(2H)-isoquinolinone is a chemical compound characterized by its isoquinolinone structure, which features a fused bicyclic system containing a nitrogen atom. The presence of a bromine atom at the 7-position and a methoxy group at the 6-position contributes to its unique reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the isoquinoline framework, which is known for various biological activities. The compound may also be of interest in research related to synthetic organic chemistry, where its functional groups can be utilized for further chemical modifications. Safety data and handling precautions should be considered, as with any brominated compound, due to potential toxicity and environmental impact.
Formula:C10H8BrNO2
InChI:InChI=1S/C10H8BrNO2/c1-14-9-4-6-2-3-12-10(13)7(6)5-8(9)11/h2-5H,1H3,(H,12,13)
InChI key:InChIKey=BIOCLYNSTMVCRB-UHFFFAOYSA-N
SMILES:O=C1C=2C(=CC(OC)=C(Br)C2)C=CN1
Synonyms:- 7-Bromo-6-methoxy-1(2H)-isoquinolinone
- 1(2H)-Isoquinolinone, 7-bromo-6-methoxy-
- 7-Bromo-6-methoxyisoquinolin-1-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
