CymitQuimica logo

CAS 924275-18-3

:

4-[2-(Trifluoromethoxy)phenyl]piperidine

Description:
4-[2-(Trifluoromethoxy)phenyl]piperidine, with the CAS number 924275-18-3, is a chemical compound characterized by its piperidine core, which is a six-membered saturated nitrogen-containing ring. This compound features a phenyl group substituted with a trifluoromethoxy group, which significantly influences its chemical properties and reactivity. The presence of the trifluoromethoxy group enhances the compound's lipophilicity and may contribute to its biological activity, making it of interest in medicinal chemistry. The trifluoromethoxy moiety is known for its electron-withdrawing properties, which can affect the compound's interaction with biological targets. Additionally, the piperidine ring can participate in various chemical reactions, including alkylation and acylation, making this compound versatile for further synthetic modifications. Its unique structure may also impart specific pharmacological properties, potentially making it a candidate for drug development. Overall, 4-[2-(Trifluoromethoxy)phenyl]piperidine is a compound of interest due to its distinctive functional groups and potential applications in pharmaceuticals.
Formula:C12H14F3NO
InChI:InChI=1S/C12H14F3NO/c13-12(14,15)17-11-4-2-1-3-10(11)9-5-7-16-8-6-9/h1-4,9,16H,5-8H2
InChI key:InChIKey=JOYJZWNORCVRQV-UHFFFAOYSA-N
SMILES:O(C(F)(F)F)C1=C(C=CC=C1)C2CCNCC2
Synonyms:
  • Piperidine, 4-[2-(trifluoromethoxy)phenyl]-
  • 4-(2-(Trifluoromethoxy)phenyl)piperidine
  • 4-[2-(Trifluoromethoxy)phenyl]piperidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.