CAS 924296-17-3

9-allyloxyiminoindeno[1,2-b]pyrazine-2,3-dicarbonitrile

Description:

9-Allyloxyiminoindeno[1,2-b]pyrazine-2,3-dicarbonitrile is a chemical compound characterized by its complex structure, which includes an indeno[1,2-b]pyrazine core, an allyloxyimino functional group, and two cyano groups. This compound is notable for its potential applications in medicinal chemistry and materials science due to its unique electronic properties and reactivity. The presence of the cyano groups contributes to its ability to participate in various chemical reactions, making it a versatile building block in organic synthesis. Additionally, the allyloxyimino group can enhance its solubility and reactivity, allowing for further functionalization. The compound's structure suggests it may exhibit interesting biological activities, although specific biological data would require further investigation. As with many organic compounds, its stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 9-allyloxyiminoindeno[1,2-b]pyrazine-2,3-dicarbonitrile represents a fascinating subject for research in both synthetic and applied chemistry.

Formula: C₁₆H₉N₅O

InChI: InChI=1/C16H9N5O/c1-2-7-22-21-15-11-6-4-3-5-10(11)14-16(15)20-13(9-18)12(8-17)19-14/h2-6H,1,7H2

SMILES: C=CCON=C1c2ccccc2c2c1nc(C#N)c(C#N)n2

9H-INDENO[1,2-B]PYRAZINE-2,3-DICARBONITRILE, 9-[(2-PROPEN-1-YLOXY)IMINO]-

CAS: 924296-17-3

Formula: C₁₆H₉N₅O

Purity: 99%

Color and Shape: Solid

Molecular weight: 287.2756

Ref: IN-DA00GU34

DUB-IN-3

CAS: 924296-17-3

DUB-IN-3

Purity: ≥95%

Molecular weight: 287.28g/mol

Ref: 54-BUP09479

DUB-IN-3

CAS: 924296-17-3

DUB-IN-3 is a potent deubiquitinase (USP) enzyme inhibitor and the IC50 for USP8 is 0.56 μM.

Formula: C₁₆H₉N₅O

Purity: 99.34%

Color and Shape: Solid

Molecular weight: 287.28

Ref: TM-T11112