CAS 924296-39-9

7-chloro-9-oxo-9H-indeno[1,2-b]pyrazine-2,3-dicarbonitrile

Description:

7-Chloro-9-oxo-9H-indeno[1,2-b]pyrazine-2,3-dicarbonitrile is a heterocyclic compound characterized by its complex structure, which includes an indeno[1,2-b]pyrazine core. This compound features a chloro substituent at the 7-position and two cyano groups at the 2 and 3 positions, contributing to its reactivity and potential applications in various fields, including medicinal chemistry and materials science. The presence of the carbonyl group at the 9-position enhances its electrophilic character, making it a candidate for further chemical modifications. Its unique structure may impart specific biological activities, which can be explored in drug discovery. The compound's solubility, stability, and reactivity are influenced by its functional groups, making it suitable for various synthetic pathways. As with many heterocycles, the electronic properties and steric factors play a crucial role in its interactions with other molecules. Overall, 7-chloro-9-oxo-9H-indeno[1,2-b]pyrazine-2,3-dicarbonitrile represents a valuable compound for research and development in chemistry and related disciplines.

Formula: C₁₃H₃ClN₄O

InChI: InChI=1/C13H3ClN4O/c14-6-1-2-7-8(3-6)13(19)12-11(7)17-9(4-15)10(5-16)18-12/h1-3H

SMILES: c1cc2c(cc1Cl)C(=O)c1c2nc(C#N)c(C#N)n1

Synonyms:

• 9H-indeno[1,2-b]pyrazine-2,3-dicarbonitrile, 7-chloro-9-oxo-

7-Chloro-9-oxo-9H-indeno[1,2-b]pyrazine-2,3-dicarbonitrile

CAS: 924296-39-9

Formula: C₁₃H₃ClN₄O

Purity: 98%

Color and Shape: Solid

Molecular weight: 266.6421

Ref: IN-DA0034E9

HBX 41108

CAS: 924296-39-9

HBX 41108

Purity: ≥95%

Molecular weight: 266.64g/mol

Ref: 54-BUP01919

HBX 41108

CAS: 924296-39-9

HBX 41108: non-competitive, reversible USP7 inhibitor; IC50: 424nM; blocks USP7-p53 deubiquitination; IC50: 0.8μM.

Formula: C₁₃H₃ClN₄O

Purity: 95.63%

Color and Shape: Solid

Molecular weight: 266.64

Ref: TM-T21527

HBX 41108

CAS: 924296-39-9

Inhibitor of ubiquitin-specific protease USP7

Formula: C₁₃H₃ClN₄O

Purity: Min. 95%

Molecular weight: 266.64 g/mol

Ref: 3D-FC145339