CAS 924305-06-6
:4-Fluoro-1H-isoindoline hydrochloride
Description:
4-Fluoro-1H-isoindoline hydrochloride is a chemical compound characterized by its isoindoline structure, which features a fused bicyclic system comprising a benzene ring and a five-membered nitrogen-containing ring. The presence of a fluorine atom at the 4-position of the isoindoline contributes to its unique reactivity and potential applications in medicinal chemistry. As a hydrochloride salt, it is typically encountered in a crystalline form, which enhances its solubility in polar solvents, making it suitable for various chemical reactions and biological assays. This compound may exhibit interesting pharmacological properties, potentially acting as a building block in drug development or as a research tool in studying biological pathways. Its specific interactions and effects would depend on the functional groups present and the overall molecular conformation. Safety data should be reviewed before handling, as with all chemical substances, to ensure proper precautions are taken.
Formula:C8H9ClFN
InChI:InChI=1S/C8H8FN.ClH/c9-8-3-1-2-6-4-10-5-7(6)8;/h1-3,10H,4-5H2;1H
InChI key:MKNPYNGKUKUSFB-UHFFFAOYSA-N
SMILES:C1C2=C(CN1)C(=CC=C2)F.Cl
Synonyms:- 4-fluoroisoindoline HCL
- 4-Fluoro-Isoindoline Hcl
- 4-Fluoroisoindoline Hydrochloride
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
4-Fluoroisoindoline hydrochloride
CAS:Formula:C8H9ClFNPurity:96%Color and Shape:SolidMolecular weight:173.624-Fluoroisoindoline hydrochloride
CAS:4-Fluoroisoindoline hydrochlorideFormula:C8H9ClFNPurity:>98%Molecular weight:173.624-Fluoroisoindoline hydrochloride
CAS:Formula:C8H9ClFNPurity:96%Color and Shape:SolidMolecular weight:173.61524-Fluoroisoindoline hydrochloride
CAS:4-Fluoroisoindoline hydrochlorideFormula:C8H9ClFNPurity:98+%Molecular weight:173.624-Fluoroisoindoline hydrochloride
CAS:4-Fluoroisoindoline hydrochlorideFormula:C8H9ClFNPurity:98%Molecular weight:173.624-Fluoroisoindoline HCl
CAS:4-Fluoroisoindoline HCl is a versatile building block that can be used in the synthesis of complex compounds, research chemicals, and reagents. It is a high quality compound with a wide range of applications. 4-Fluoroisoindoline HCl is also useful as an intermediate for the synthesis of other compounds, or as a reaction component for organic chemistry reactions. This compound has been shown to have potential medical uses in the treatment of Parkinson's disease and cancer.
Formula:C8H8FN·HClPurity:Min. 95%Color and Shape:White to brown solid.Molecular weight:173.61 g/mol
