CAS 924312-10-7

4-Bromo-1-[2-[[(1,1-dimethylethyl)dimethylsilyl]oxy]ethyl]-2-fluorobenzene

Description:

4-Bromo-1-[2-[[(1,1-dimethylethyl)dimethylsilyl]oxy]ethyl]-2-fluorobenzene is an organic compound characterized by its complex structure, which includes a bromine atom and a fluorine atom attached to a benzene ring. The presence of a dimethylsilyl group indicates that the compound has potential applications in organosilicon chemistry, particularly in the synthesis of siloxane derivatives. The tert-butyl group contributes to the steric bulk, which can influence the compound's reactivity and solubility. This compound is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its chemical properties may include moderate polarity due to the presence of the silyl ether and halogen substituents, which can affect its interactions in various chemical environments. Additionally, the compound may exhibit interesting reactivity patterns typical of halogenated aromatic compounds, such as electrophilic substitution or nucleophilic displacement, making it a candidate for further chemical transformations in synthetic organic chemistry.

Formula: C₁₄H₂₂BrFOSi

InChI: InChI=1S/C14H22BrFOSi/c1-14(2,3)18(4,5)17-9-8-11-6-7-12(15)10-13(11)16/h6-7,10H,8-9H2,1-5H3

InChI key: InChIKey=IMURGIHQMHJSAW-UHFFFAOYSA-N

SMILES: C(CO[Si](C(C)(C)C)(C)C)C1=C(F)C=C(Br)C=C1

Synonyms:

• [2-(4-Bromo-2-fluorophenyl)ethoxy](tert-butyl)dimethylsilane
• 4-Bromo-1-[2-[[(1,1-dimethylethyl)dimethylsilyl]oxy]ethyl]-2-fluorobenzene
• Benzene, 4-bromo-1-[2-[[(1,1-dimethylethyl)dimethylsilyl]oxy]ethyl]-2-fluoro-