CymitQuimica logo

CAS 92437-43-9

:

2-methyl-1-phenyl-1H-benzimidazole-5-carboxylic acid

Description:
2-Methyl-1-phenyl-1H-benzimidazole-5-carboxylic acid is a chemical compound characterized by its unique structure, which includes a benzimidazole core substituted with a methyl group and a phenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential solubility in organic solvents and moderate stability under standard conditions. The presence of the carboxylic acid functional group suggests it may exhibit acidic properties, allowing it to participate in various chemical reactions, such as esterification or amidation. Additionally, the compound may display biological activity, making it of interest in pharmaceutical research. Its molecular structure contributes to its potential interactions with biological targets, which can be explored for therapeutic applications. As with many organic compounds, the specific physical properties such as melting point, boiling point, and solubility can vary based on environmental conditions and the presence of other substances. Overall, 2-methyl-1-phenyl-1H-benzimidazole-5-carboxylic acid represents a versatile compound with potential applications in medicinal chemistry and material science.
Formula:C15H12N2O2
InChI:InChI=1/C15H12N2O2/c1-10-16-13-9-11(15(18)19)7-8-14(13)17(10)12-5-3-2-4-6-12/h2-9H,1H3,(H,18,19)
InChI key:InChIKey=HLIJMHKQYSUDOJ-UHFFFAOYSA-N
SMILES:CC=1N(C=2C(N1)=CC(C(O)=O)=CC2)C3=CC=CC=C3
Synonyms:
  • 1H-Benzimidazole-5-carboxylic acid, 2-methyl-1-phenyl-
  • 2-Methyl-1-phenyl-1H-1,3-benzodiazole-5-carboxylic acid
  • 2-Methyl-1-phenyl-1H-benzo[d]imidazole-5-carboxylicacid
  • 2-Methyl-1-phenyl-1H-benzoimidazole-5-carboxylic acid
  • 2-Methyl-1-phenylbenzimidazole-5-carboxylic acid
  • 5-Benzimidazolecarboxylic acid, 2-methyl-1-phenyl-
  • 2-Methyl-1-phenyl-1H-benzimidazole-5-carboxylic acid
  • 2-Methyl-1-phenyl-1H-benzimidazole-5-carboxylic acid
  • See more synonyms
Found 3 products.