
CAS 92451-00-8
:Poly(oxy-1,2-ethanediyl), α-[2-[[4-[(2,5-dioxo-1-pyrrolidinyl)oxy]-1,4-dioxobutyl]amino]ethyl]-ω-methoxy-
Description:
Poly(oxy-1,2-ethanediyl), α-[2-[[4-[(2,5-dioxo-1-pyrrolidinyl)oxy]-1,4-dioxobutyl]amino]ethyl]-ω-methoxy- is a synthetic polymer characterized by its polyether backbone, which is derived from ethylene oxide. This compound features functional groups that enhance its solubility and reactivity, including methoxy and amine functionalities, which can facilitate interactions with biological systems. The presence of a pyrrolidinyl moiety suggests potential applications in drug delivery or as a biocompatible material, as it may enhance the compound's ability to interact with biological membranes. The dioxobutyl group indicates that the polymer may have reactive sites that can participate in further chemical modifications or cross-linking reactions. Overall, this polymer is likely to exhibit properties such as good solubility in polar solvents, potential biocompatibility, and versatility in chemical reactivity, making it suitable for various applications in pharmaceuticals, materials science, and biotechnology. Its specific characteristics, such as molecular weight and thermal stability, would depend on the polymerization conditions and the degree of polymerization achieved.
Formula:(C2H4O)nC11H16N2O6
Synonyms:- Poly(oxy-1,2-ethanediyl), α-[2-[[4-[(2,5-dioxo-1-pyrrolidinyl)oxy]-1,4-dioxobutyl]amino]ethyl]-ω-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
O-[(N-Succinimidyl)succinyl-aminoethyl]-O′-methylpolyethylene glycol 2′000
CAS:Formula:C13H20N2O7Molecular weight:316.3071
