CymitQuimica logo

CAS 92455-12-4

:

2-{[(4-methoxyphenyl)acetyl]amino}prop-2-enoic acid

Description:
2-{[(4-Methoxyphenyl)acetyl]amino}prop-2-enoic acid, also known by its CAS number 92455-12-4, is an organic compound characterized by its unique structure, which includes an amino acid derivative with a methoxyphenyl group. This compound features a prop-2-enoic acid backbone, indicating the presence of a double bond between the second and third carbon atoms, which contributes to its reactivity. The acetylamino group enhances its potential for biological activity, making it of interest in pharmaceutical research. The methoxy group on the phenyl ring can influence the compound's solubility and interaction with biological targets. Typically, compounds of this nature may exhibit properties such as moderate to high polarity due to the presence of both carboxylic acid and amine functionalities, which can facilitate hydrogen bonding. Additionally, the structural features suggest potential applications in medicinal chemistry, particularly in the development of anti-inflammatory or analgesic agents. Overall, this compound's characteristics make it a subject of interest for further study in various chemical and biological contexts.
Formula:C12H13NO4
InChI:InChI=1/C12H13NO4/c1-8(12(15)16)13-11(14)7-9-3-5-10(17-2)6-4-9/h3-6H,1,7H2,2H3,(H,13,14)(H,15,16)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.