CAS 92457-51-7
:5-(7-nitro-2,1,3-benzoxadiazol-4-yl)pentyl methylphosphonofluoridate
Description:
5-(7-nitro-2,1,3-benzoxadiazol-4-yl)pentyl methylphosphonofluoridate, with CAS number 92457-51-7, is a synthetic chemical compound that belongs to the class of organophosphates. This substance is characterized by its complex structure, which includes a phosphonate group, a fluorine atom, and a nitro-substituted benzoxadiazole moiety. The presence of the nitro group contributes to its potential as a fluorescent probe, making it useful in various biochemical applications, particularly in the study of biological systems. The pentyl chain enhances its lipophilicity, allowing for better membrane permeability. As an organophosphate, it may exhibit neurotoxic properties by inhibiting acetylcholinesterase, an enzyme critical for neurotransmitter regulation. Safety and handling precautions are essential due to its potential toxicity. Overall, this compound's unique structural features and properties make it of interest in both research and potential applications in fields such as biochemistry and pharmacology.
Formula:C12H15FN3O5P
InChI:InChI=1/C12H15FN3O5P/c1-22(13,19)20-8-4-2-3-5-9-6-7-10(16(17)18)12-11(9)14-21-15-12/h6-7H,2-5,8H2,1H3
SMILES:CP(=O)(F)OCCCCCc1ccc(c2c1non2)N(=O)=O
Synonyms:- Phosphonofluoridic acid, methyl-, 5-(7-nitro-4-benzofurazanyl)pentyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
7-[5-(Fluoro-methyl-phosphoryl)oxypentyl]-4-nitro-2,1,3-benzoxadiazole
CAS:Controlled Product7-[5-(Fluoro-methyl-phosphoryl)oxypentyl]-4-nitro-2,1,3-benzoxadiazole is a reactivator of the central nervous system. It is a noncompetitive antagonist at muscarinic receptors and blocks postsynaptic acetylcholine release from cholinergic neurons. It has been shown to have no effect on blood pressure but does cause an increase in locomotor activity in animals. This drug binds to the hippocampal formation and the ventral hippocampus, which are areas of the brain that are involved in memory and spatial navigation. The distribution of this drug postulated to be due to its ability to penetrate micron sized openings in cell membranes.
Formula:C12H15FN3O5PPurity:Min. 95%Molecular weight:331.24 g/mol
