CAS 92466-70-1
:bis(2,2,2-trifluoroethyl) phosphite
Description:
Bis(2,2,2-trifluoroethyl) phosphite is an organophosphorus compound characterized by its phosphite functional group, where two 2,2,2-trifluoroethyl groups are attached to a phosphorus atom. This compound is typically a colorless to pale yellow liquid with a distinctive odor. It is known for its high thermal stability and low volatility, making it suitable for various applications, including as a reagent in organic synthesis and as a potential intermediate in the production of fluorinated compounds. The presence of trifluoroethyl groups imparts unique properties, such as increased lipophilicity and potential bioactivity. Additionally, bis(2,2,2-trifluoroethyl) phosphite exhibits moderate toxicity, necessitating careful handling and appropriate safety measures during use. Its reactivity can be influenced by the presence of the electronegative fluorine atoms, which can affect its behavior in chemical reactions, particularly in nucleophilic substitutions. Overall, this compound is of interest in both industrial and research settings due to its distinctive chemical properties and potential applications.
Formula:C4H4F6O3P
InChI:InChI=1/C4H4F6O3P/c5-3(6,7)1-12-14(11)13-2-4(8,9)10/h1-2H2/q+1
SMILES:C(C(F)(F)F)OP(O)OCC(F)(F)F
Synonyms:- Oxo[Bis(2,2,2-Trifluoroethoxy)]Phosphonium
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Bis(2,2,2-trifluoroethyl) Phosphite
CAS:Formula:C4H5F6O3PPurity:>94.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:246.05Bis(2,2,2-trifluoroethyl) phosphite, tech. 90%
CAS:Bis(2,2,2-trifluoroethyl) phosphite was used in the synthesis of bis(2,2,2-trifluoroethyl phosphorochloridate. It was also employed as reagent for the synthesis of mono- and diesters of phosphorous acid. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product porFormula:C4F6H5O3PPurity:90%Molecular weight:246.05BIS(2,2,2-TRIFLUOROETHYL) PHOSPHITE
CAS:Formula:C4H5F6O3PPurity:94%Color and Shape:LiquidMolecular weight:246.0449Bis(2,2,2-Trifluoroethyl) Phosphonate
CAS:Bis(2,2,2-Trifluoroethyl) PhosphonatePurity:94%Molecular weight:246.04g/mol



