CAS 924663-39-8
:Pyridine, 2-(chloromethyl)-4-(3-methoxypropoxy)-3-methyl-, 1-oxide
Description:
Pyridine, 2-(chloromethyl)-4-(3-methoxypropoxy)-3-methyl-, 1-oxide, identified by CAS number 924663-39-8, is a chemical compound that features a pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound is characterized by the presence of a chloromethyl group and a methoxypropoxy substituent, which contribute to its unique chemical properties. The chloromethyl group can participate in nucleophilic substitution reactions, making the compound potentially reactive in various chemical contexts. The methoxypropoxy group enhances solubility in organic solvents and may influence the compound's biological activity. As a pyridine derivative, it may exhibit basic properties due to the nitrogen atom's lone pair, allowing it to act as a weak base. Additionally, the presence of the 1-oxide functional group suggests that the compound may have oxidizing characteristics. Overall, this compound's structure suggests potential applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis, although specific applications would depend on further research and characterization.
Formula:C11H16ClNO3
InChI:InChI=1S/C11H16ClNO3/c1-9-10(8-12)13(14)5-4-11(9)16-7-3-6-15-2/h4-5H,3,6-8H2,1-2H3
InChI key:InChIKey=FEEQDQKECPZTPQ-UHFFFAOYSA-N
SMILES:O(CCCOC)C=1C(C)=C(CCl)N(=O)=CC1
Synonyms:- 2-Chloromethyl-3-methyl-4-(3-methoxypropoxy)pyridine-1-oxide
- Pyridine, 2-(chloromethyl)-4-(3-methoxypropoxy)-3-methyl-, 1-oxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
