CAS 924663-40-1
:2-[[[4-(3-Methoxypropoxy)-3-methyl-1-oxido-2-pyridinyl]methyl]thio]-1H-benzimidazole
Description:
2-[[[4-(3-Methoxypropoxy)-3-methyl-1-oxido-2-pyridinyl]methyl]thio]-1H-benzimidazole, identified by CAS number 924663-40-1, is a chemical compound characterized by its complex structure, which includes a benzimidazole core and various functional groups. The presence of a methoxypropoxy group and a pyridine ring suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. This compound may exhibit properties such as antimicrobial or anti-inflammatory activity, although specific biological activities would depend on further empirical studies. The thioether linkage in its structure could influence its solubility and reactivity, making it a candidate for various chemical reactions. Additionally, the presence of the oxido group indicates potential for redox activity. Overall, the unique combination of functional groups in this compound may contribute to its potential utility in drug design and development, warranting further investigation into its pharmacological properties and mechanisms of action.
Formula:C18H21N3O3S
InChI:InChI=1S/C18H21N3O3S/c1-13-16(21(22)9-8-17(13)24-11-5-10-23-2)12-25-18-19-14-6-3-4-7-15(14)20-18/h3-4,6-9H,5,10-12H2,1-2H3,(H,19,20)
InChI key:InChIKey=CGSOUPMFBQXHAH-UHFFFAOYSA-N
SMILES:S(CC1=C(C)C(OCCCOC)=CC=N1=O)C=2NC=3C(N2)=CC=CC3
Synonyms:- 1H-Benzimidazole, 2-[[[4-(3-methoxypropoxy)-3-methyl-1-oxido-2-pyridinyl]methyl]thio]-
- 2-[[[4-(3-Methoxypropoxy)-3-methyl-1-oxido-2-pyridinyl]methyl]thio]-1H-benzimidazole
- 2-[[[3-Methyl-4-(3-methoxypropoxy)-1-oxo-2-pyridinyl]methyl]sulfanyl]-1H-benzimidazole
- 2-[[4-(3-Methoxypropoxy)-3-methyl-1-oxidopyridin-1-ium-2-yl]methylsulfanyl]-1H-benzimidazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Rabeprazole Sulfide N-Oxide
CAS:Formula:C18H21N3O3SColor and Shape:White To Off-White SolidMolecular weight:359.44Rabeprazole Sulfide N-Oxide
CAS:Applications Rabeprazole Sulfide N-Oxide (cas# 924663-40-1) is a compound useful in organic synthesis.
Formula:C18H21N3O3SColor and Shape:NeatMolecular weight:359.44


