CAS 92471-23-3

(1R,2S,4R)-2-Hydroxy-α,α,4-trimethylcyclohexanemethanol

Description:

(1R,2S,4R)-2-Hydroxy-α,α,4-trimethylcyclohexanemethanol, with the CAS number 92471-23-3, is a chiral organic compound characterized by its complex cyclohexane structure featuring multiple methyl groups and a hydroxyl functional group. This compound is a type of alcohol, specifically a secondary alcohol, due to the presence of the hydroxyl (-OH) group attached to a carbon that is connected to two other carbon atoms. The stereochemistry indicated by the (1R,2S,4R) notation suggests specific spatial arrangements of the atoms, which can influence its physical and chemical properties, such as solubility and reactivity. Typically, compounds like this may exhibit interesting biological activities and can be relevant in the synthesis of pharmaceuticals or as intermediates in organic chemistry. Its physical properties, such as boiling point and melting point, would depend on the molecular interactions and the presence of functional groups, which can also affect its behavior in various chemical reactions.

Formula: C₁₀H₂₀O₂

InChI: InChI=1S/C10H20O2/c1-7-4-5-8(9(11)6-7)10(2,3)12/h7-9,11-12H,4-6H2,1-3H3/t7-,8-,9+/m1/s1

InChI key: InChIKey=LMXFTMYMHGYJEI-HLTSFMKQSA-N

SMILES: [C@](C)(C)(O)[C@H]1[C@@H](O)C[C@H](C)CC1

Synonyms:

• (1R,2S,4R)-2-Hydroxy-α,α,4-trimethylcyclohexanemethanol
• Cyclohexanemethanol,2-hydroxy-a,a,4-trimethyl-, [1R-(1a,2a,4b)]-
• Cyclohexanemethanol, 2-hydroxy-α,α,4-trimethyl-, (1R,2S,4R)-

(1R,2S,4R)-2-Hydroxy-a,a,4-trimethylcyclohexanemethanol

Controlled Product

CAS: 92471-23-3

Formula: C₁₀H₂₀O₂

Color and Shape: Neat

Molecular weight: 172.26

Ref: TR-H296845