CymitQuimica logo

CAS 924818-17-7

:

3-Bromo-2-(trifluoromethyl)thiophene

Description:
3-Bromo-2-(trifluoromethyl)thiophene is a heterocyclic organic compound characterized by the presence of a thiophene ring, which is a five-membered aromatic ring containing sulfur. The compound features a bromine atom at the 3-position and a trifluoromethyl group (-CF3) at the 2-position of the thiophene ring. This substitution pattern contributes to its unique chemical properties, including increased electron-withdrawing effects due to the trifluoromethyl group, which can enhance the compound's reactivity in various chemical reactions. The presence of bromine also provides opportunities for further functionalization through nucleophilic substitution reactions. 3-Bromo-2-(trifluoromethyl)thiophene is typically used in organic synthesis and materials science, particularly in the development of electronic materials and pharmaceuticals. Its physical properties, such as solubility and melting point, can vary based on the specific conditions and solvents used. Overall, this compound is of interest in both academic research and industrial applications due to its distinctive structural features and reactivity.
Formula:C5H2BrF3S
InChI:InChI=1S/C5H2BrF3S/c6-3-1-2-10-4(3)5(7,8)9/h1-2H
InChI key:InChIKey=WAEYJGSTKDPCSW-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(Br)C=CS1
Synonyms:
  • 3-Bromo-2-(trifluoromethyl)thiophene
  • Thiophene, 3-bromo-2-(trifluoromethyl)-
Found 3 products.