CAS 924831-73-2

Piperazine, 1-[4-(4-methylphenyl)-2-thiazolyl]-

Description:

Piperazine, 1-[4-(4-methylphenyl)-2-thiazolyl]- is a chemical compound characterized by its piperazine core, which is a six-membered heterocyclic amine. This compound features a thiazole ring substituted with a 4-methylphenyl group, contributing to its unique properties. The presence of the thiazole moiety often imparts biological activity, making such compounds of interest in medicinal chemistry. Piperazine derivatives are known for their versatility, often exhibiting pharmacological effects such as anxiolytic, antidepressant, or antipsychotic activities. The specific structure of this compound suggests potential interactions with various biological targets, which could be explored for therapeutic applications. Additionally, the compound's solubility, stability, and reactivity can be influenced by the substituents on the piperazine and thiazole rings. As with many organic compounds, safety and handling precautions are essential, particularly in laboratory settings, due to potential toxicity or reactivity. Overall, this compound represents a class of substances that may have significant implications in drug development and pharmacology.

Formula: C₁₄H₁₇N₃S

InChI: InChI=1S/C14H17N3S/c1-11-2-4-12(5-3-11)13-10-18-14(16-13)17-8-6-15-7-9-17/h2-5,10,15H,6-9H2,1H3

InChI key: InChIKey=ILARXIZEOAQJGO-UHFFFAOYSA-N

SMILES: CC1=CC=C(C=2N=C(SC2)N3CCNCC3)C=C1

Synonyms:

• Piperazine, 1-[4-(4-methylphenyl)-2-thiazolyl]-