CAS 92484-23-6

2-(trifluoromethyl)-L-histidyl-N-{[(2S)-5-oxopyrrolidin-2-yl]carbonyl}-L-prolinamide

Description:

2-(Trifluoromethyl)-L-histidyl-N-{[(2S)-5-oxopyrrolidin-2-yl]carbonyl}-L-prolinamide is a complex organic compound characterized by its unique structural features, including a trifluoromethyl group and a pyrrolidine moiety. The presence of the trifluoromethyl group enhances the compound's lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry. The compound contains amino acid residues, specifically L-histidine and L-proline, which contribute to its potential role in peptide synthesis and biological interactions. The carbonyl group linked to the pyrrolidine ring suggests potential reactivity, possibly participating in various chemical reactions such as amide bond formation. This compound may exhibit specific stereochemistry due to the presence of chiral centers, which can significantly affect its pharmacological properties. Overall, its structural complexity and functional groups suggest potential applications in drug development, particularly in targeting specific biological pathways or receptors. Further studies would be necessary to elucidate its full range of properties and potential uses in therapeutic contexts.

Formula: C₁₇H₂₁F₃N₆O₄

InChI: InChI=1/C17H21F3N6O4/c18-17(19,20)16-22-7-8(23-16)6-9(21)15(30)26-5-1-2-11(26)14(29)25-13(28)10-3-4-12(27)24-10/h7,9-11H,1-6,21H2,(H,22,23)(H,24,27)(H,25,28,29)/t9-,10-,11-/m0/s1

SMILES: C1C[C@@H](C(=O)N=C([C@@H]2CCC(=N2)O)O)N(C1)C(=O)[C@H](Cc1cnc(C(F)(F)F)[nH]1)N