CAS 924845-80-7

6-amino-5,7,8-trimethyl-4H-1,4-benzoxazin-3-one

Description:

6-amino-5,7,8-trimethyl-4H-1,4-benzoxazin-3-one is a chemical compound characterized by its unique structure, which includes a benzoxazine ring fused with an amino group and multiple methyl substituents. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the amino group, which can participate in various chemical reactions. The trimethyl groups contribute to its hydrophobic characteristics, influencing its solubility and interaction with biological membranes. The compound may also display antioxidant properties, making it of interest in pharmaceutical and agricultural applications. Its CAS number, 924845-80-7, allows for easy identification in chemical databases. Overall, the structural features of 6-amino-5,7,8-trimethyl-4H-1,4-benzoxazin-3-one suggest potential utility in various fields, including medicinal chemistry and agrochemicals, although specific applications would depend on further research into its biological activity and stability.

Formula: C₁₁H₁₄N₂O₂

InChI: InChI=1/C11H14N2O2/c1-5-6(2)11-10(7(3)9(5)12)13-8(14)4-15-11/h4,12H2,1-3H3,(H,13,14)

SMILES: Cc1c(C)c2c(c(C)c1N)N=C(CO2)O

Synonyms:

• 2H-1,4-benzoxazin-3(4H)-one, 6-amino-5,7,8-trimethyl-

6-Amino-5,7,8-trimethyl-2h-1,4-benzoxazin-3(4h)-one

CAS: 924845-80-7

Formula: C₁₁H₁₄N₂O₂

Molecular weight: 206.2411

Ref: IN-DA006HUR

6-amino-5,7,8-trimethyl-2H-1,4-benzoxazin-3(4H)-one

CAS: 924845-80-7

Formula: C₁₁H₁₄N₂O₂

Purity: 95.0%

Molecular weight: 206.245

Ref: 10-F310983