CAS 924846-10-6

2-[[2-(Dimethylamino)-2-oxoethyl]amino]benzoic acid

Description:

2-[[2-(Dimethylamino)-2-oxoethyl]amino]benzoic acid, with the CAS number 924846-10-6, is an organic compound characterized by its structure, which includes a benzoic acid moiety and a dimethylamino group. This compound typically exhibits properties associated with both amines and carboxylic acids, such as the ability to form hydrogen bonds and participate in acid-base reactions. It is likely to be a solid at room temperature, with potential solubility in polar solvents due to the presence of the carboxylic acid functional group. The dimethylamino group may impart basic characteristics, allowing it to act as a weak base. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. As with many organic compounds, safety data should be consulted to understand its handling and toxicity profiles.

Formula: C₁₁H₁₄N₂O₃

InChI: InChI=1S/C11H14N2O3/c1-13(2)10(14)7-12-9-6-4-3-5-8(9)11(15)16/h3-6,12H,7H2,1-2H3,(H,15,16)

InChI key: InChIKey=YJSJFXCSLOTJLQ-UHFFFAOYSA-N

SMILES: N(CC(N(C)C)=O)C1=C(C(O)=O)C=CC=C1

Synonyms:

• 2-[[2-(Dimethylamino)-2-oxoethyl]amino]benzoic acid
• Benzoic acid, 2-[[2-(dimethylamino)-2-oxoethyl]amino]-