CymitQuimica logo

CAS 924858-84-4

:

6-Amino-5-[(2,3-dihydro-1,4-benzodioxin-6-yl)carbonyl]-2,3-dihydro-1H-pyrrolizine-7-carbonitrile

Description:
6-Amino-5-[(2,3-dihydro-1,4-benzodioxin-6-yl)carbonyl]-2,3-dihydro-1H-pyrrolizine-7-carbonitrile is a complex organic compound characterized by its unique structural features, including a pyrrolizine core and a benzodioxin moiety. The presence of an amino group and a carbonitrile functional group contributes to its potential reactivity and biological activity. This compound may exhibit properties such as solubility in organic solvents, depending on its specific functional groups and molecular interactions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of bioactive functional groups. The compound's CAS number, 924858-84-4, allows for precise identification and reference in chemical databases. As with many organic compounds, its stability, reactivity, and interactions with other substances would be influenced by environmental conditions such as pH, temperature, and the presence of other chemicals. Further studies would be necessary to fully elucidate its properties and potential applications in various fields.
Formula:C17H15N3O3
InChI:InChI=1S/C17H15N3O3/c18-9-11-12-2-1-5-20(12)16(15(11)19)17(21)10-3-4-13-14(8-10)23-7-6-22-13/h3-4,8H,1-2,5-7,19H2
InChI key:InChIKey=IUUQGJSEJWDBAJ-UHFFFAOYSA-N
SMILES:C(=O)(C=1N2C(=C(C#N)C1N)CCC2)C=3C=C4C(=CC3)OCCO4
Synonyms:
  • 6-Amino-5-[(2,3-dihydro-1,4-benzodioxin-6-yl)carbonyl]-2,3-dihydro-1H-pyrrolizine-7-carbonitrile
  • 1H-Pyrrolizine-7-carbonitrile, 6-amino-5-[(2,3-dihydro-1,4-benzodioxin-6-yl)carbonyl]-2,3-dihydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.