
CAS 924858-86-6
:3,4-Dihydro-8-methoxy-2H-1,5-benzodioxepin-7-propanoic acid
Description:
3,4-Dihydro-8-methoxy-2H-1,5-benzodioxepin-7-propanoic acid, with the CAS number 924858-86-6, is a chemical compound characterized by its unique bicyclic structure, which includes a benzodioxepin core. This compound features a methoxy group and a propanoic acid moiety, contributing to its potential biological activity. The presence of the dioxepin ring suggests that it may exhibit interesting chemical reactivity and stability under various conditions. Its molecular structure may allow for interactions with biological targets, making it of interest in pharmaceutical research. The compound's solubility, melting point, and other physical properties would depend on its specific molecular interactions and functional groups. Additionally, its synthesis and potential applications in medicinal chemistry could be explored, particularly in the context of drug development. Overall, 3,4-Dihydro-8-methoxy-2H-1,5-benzodioxepin-7-propanoic acid represents a fascinating subject for further investigation in both synthetic and applied chemistry.
Formula:C13H16O5
InChI:InChI=1S/C13H16O5/c1-16-10-8-12-11(17-5-2-6-18-12)7-9(10)3-4-13(14)15/h7-8H,2-6H2,1H3,(H,14,15)
InChI key:InChIKey=GJDCPYCUMMYZAZ-UHFFFAOYSA-N
SMILES:C(CC(O)=O)C1=C(OC)C=C2C(=C1)OCCCO2
Synonyms:- 3,4-Dihydro-8-methoxy-2H-1,5-benzodioxepin-7-propanoic acid
- 2H-1,5-Benzodioxepin-7-propanoic acid, 3,4-dihydro-8-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.