CymitQuimica logo

CAS 924858-90-2

:

N,N′-(2-Pyridinylmethylene)bis[acetamide]

Description:
N,N′-(2-Pyridinylmethylene)bis[acetamide], with the CAS number 924858-90-2, is an organic compound characterized by its dual acetamide functional groups linked by a 2-pyridinylmethylene bridge. This compound typically exhibits a solid state at room temperature and is soluble in polar organic solvents, reflecting its amide functionalities. The presence of the pyridine ring contributes to its aromatic character, which can influence its reactivity and interaction with other molecules. The compound may exhibit biological activity, making it of interest in medicinal chemistry and drug design. Its structure allows for potential hydrogen bonding due to the amide groups, which can enhance its solubility and interaction with biological targets. Additionally, the compound's properties, such as melting point, boiling point, and spectral characteristics, can vary based on the specific conditions and purity. Overall, N,N′-(2-Pyridinylmethylene)bis[acetamide] is a versatile compound with potential applications in various fields, including pharmaceuticals and materials science.
Formula:C10H13N3O2
InChI:InChI=1S/C10H13N3O2/c1-7(14)12-10(13-8(2)15)9-5-3-4-6-11-9/h3-6,10H,1-2H3,(H,12,14)(H,13,15)
InChI key:InChIKey=QBJYNWITKJOTEE-UHFFFAOYSA-N
SMILES:C(NC(C)=O)(NC(C)=O)C1=CC=CC=N1
Synonyms:
  • Acetamide, N,N′-(2-pyridinylmethylene)bis-
  • N,N′-(2-Pyridinylmethylene)bis[acetamide]
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.