CAS 924859-04-1

Ethyl 5-(1-hydroxycyclopentyl)-3-isoxazolecarboxylate

Description:

Ethyl 5-(1-hydroxycyclopentyl)-3-isoxazolecarboxylate is a chemical compound characterized by its unique structural features, which include an isoxazole ring and a cyclopentyl group. The presence of the isoxazole moiety suggests potential biological activity, as isoxazoles are often found in various pharmaceuticals and agrochemicals. The ethyl ester functional group contributes to its solubility and reactivity, making it suitable for various synthetic applications. The hydroxy group on the cyclopentyl ring may enhance its interaction with biological targets, potentially influencing its pharmacokinetic properties. This compound is likely to be of interest in medicinal chemistry and drug development due to its structural complexity and the potential for diverse biological activities. As with many organic compounds, its stability, reactivity, and interactions with other substances would depend on environmental conditions such as pH, temperature, and the presence of solvents or catalysts. Further studies would be necessary to fully elucidate its properties and potential applications in various fields.

Formula: C₁₁H₁₅NO₄

InChI: InChI=1S/C11H15NO4/c1-2-15-10(13)8-7-9(16-12-8)11(14)5-3-4-6-11/h7,14H,2-6H2,1H3

InChI key: InChIKey=QDQBTUACYFLWGK-UHFFFAOYSA-N

SMILES: OC1(CCCC1)C2=CC(C(OCC)=O)=NO2

Synonyms:

• Ethyl 5-(1-hydroxycyclopentyl)-3-isoxazolecarboxylate
• 3-Isoxazolecarboxylic acid, 5-(1-hydroxycyclopentyl)-, ethyl ester