CAS 924859-05-2

Ethyl 5-(1-cyclopropyl-1-hydroxyethyl)-3-isoxazolecarboxylate

Description:

Ethyl 5-(1-cyclopropyl-1-hydroxyethyl)-3-isoxazolecarboxylate, identified by its CAS number 924859-05-2, is a chemical compound characterized by its unique isoxazole ring structure, which contributes to its potential biological activity. This compound features an ethyl ester functional group, enhancing its solubility and reactivity. The presence of a cyclopropyl group and a hydroxyethyl substituent indicates that it may exhibit interesting steric and electronic properties, potentially influencing its interactions in biological systems. Isoxazole derivatives are often studied for their pharmacological properties, including anti-inflammatory and analgesic effects. The specific arrangement of atoms in this compound suggests it may participate in various chemical reactions, making it a candidate for further research in medicinal chemistry. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its stability and reactivity would be assessed through various analytical methods. Overall, this compound represents a fascinating area of study within the field of organic and medicinal chemistry.

Formula: C₁₁H₁₅NO₄

InChI: InChI=1S/C11H15NO4/c1-3-15-10(13)8-6-9(16-12-8)11(2,14)7-4-5-7/h6-7,14H,3-5H2,1-2H3

InChI key: InChIKey=SQKPXYNHYHUGIS-UHFFFAOYSA-N

SMILES: C(C)(O)(C1=CC(C(OCC)=O)=NO1)C2CC2

Synonyms:

• 3-Isoxazolecarboxylic acid, 5-(1-cyclopropyl-1-hydroxyethyl)-, ethyl ester
• Ethyl 5-(1-cyclopropyl-1-hydroxyethyl)-3-isoxazolecarboxylate