
CAS 924859-08-5
:5-(1-Hydroxycyclopentyl)-3-isoxazolecarboxylic acid
Description:
5-(1-Hydroxycyclopentyl)-3-isoxazolecarboxylic acid is a chemical compound characterized by its unique structural features, which include a cyclopentyl group and an isoxazole ring. The presence of the hydroxy group on the cyclopentyl moiety contributes to its potential for hydrogen bonding, influencing its solubility and reactivity. This compound is often studied for its biological activity, particularly in the context of medicinal chemistry, where modifications to the isoxazole and carboxylic acid functionalities can affect pharmacological properties. The isoxazole ring itself is a five-membered heterocyclic structure containing both nitrogen and oxygen, which can impart specific electronic properties and reactivity patterns. Additionally, the carboxylic acid group is known for its acidity and ability to participate in various chemical reactions, including esterification and amidation. Overall, the characteristics of this compound make it of interest in various fields, including drug development and synthetic organic chemistry, where its unique structure may lead to novel therapeutic agents.
Formula:C9H11NO4
InChI:InChI=1S/C9H11NO4/c11-8(12)6-5-7(14-10-6)9(13)3-1-2-4-9/h5,13H,1-4H2,(H,11,12)
InChI key:InChIKey=VHFYOQNGHUWEMI-UHFFFAOYSA-N
SMILES:OC1(CCCC1)C2=CC(C(O)=O)=NO2
Synonyms:- 3-Isoxazolecarboxylic acid, 5-(1-hydroxycyclopentyl)-
- 5-(1-Hydroxycyclopentyl)isoxazole-3-carboxylic acid
- 5-(1-Hydroxycyclopentyl)-3-isoxazolecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.