
CAS 924859-12-1
:4,5-Dihydro-5-[(7-methoxy-1,3-benzodioxol-5-yl)methyl]-3-isoxazolecarboxamide
Description:
4,5-Dihydro-5-[(7-methoxy-1,3-benzodioxol-5-yl)methyl]-3-isoxazolecarboxamide is a chemical compound characterized by its unique structural features, which include an isoxazole ring and a methoxy-substituted benzodioxole moiety. The presence of the isoxazole ring contributes to its potential biological activity, as this functional group is often found in various pharmaceuticals. The compound's molecular structure suggests it may exhibit properties such as moderate to high lipophilicity due to the aromatic components, which can influence its solubility and permeability in biological systems. Additionally, the carboxamide functional group may enhance its interaction with biological targets, potentially leading to various pharmacological effects. The methoxy group can also play a role in modulating the compound's reactivity and stability. Overall, this compound's characteristics suggest it may be of interest in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific biological activities and applications would require further investigation through experimental studies.
Formula:C13H14N2O5
InChI:InChI=1S/C13H14N2O5/c1-17-10-3-7(4-11-12(10)19-6-18-11)2-8-5-9(13(14)16)15-20-8/h3-4,8H,2,5-6H2,1H3,(H2,14,16)
InChI key:InChIKey=CDMIUDSIVRSTLI-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(=CC(CC3CC(C(N)=O)=NO3)=C1)OCO2
Synonyms:- 4,5-Dihydro-5-[(7-methoxy-1,3-benzodioxol-5-yl)methyl]-3-isoxazolecarboxamide
- 3-Isoxazolecarboxamide, 4,5-dihydro-5-[(7-methoxy-1,3-benzodioxol-5-yl)methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.