
CAS 924859-14-3
:2-(4-Chlorophenyl)-5-(3,4-dimethoxyphenyl)-1H-imidazole
Description:
2-(4-Chlorophenyl)-5-(3,4-dimethoxyphenyl)-1H-imidazole, with the CAS number 924859-14-3, is a chemical compound characterized by its imidazole core, which is a five-membered heterocyclic ring containing two nitrogen atoms. This compound features a 4-chlorophenyl group and a 3,4-dimethoxyphenyl group, contributing to its unique chemical properties and potential biological activity. The presence of the chlorine atom and methoxy groups enhances its lipophilicity and may influence its interaction with biological targets. Typically, compounds of this nature are studied for their pharmacological properties, including potential anti-cancer or anti-inflammatory activities. The imidazole ring is known for its role in various biological systems, including enzyme function and receptor binding. Additionally, the compound's solubility, stability, and reactivity can be influenced by the substituents on the aromatic rings. Overall, 2-(4-Chlorophenyl)-5-(3,4-dimethoxyphenyl)-1H-imidazole represents a class of compounds that may have significant implications in medicinal chemistry and drug development.
Formula:C17H15ClN2O2
InChI:InChI=1S/C17H15ClN2O2/c1-21-15-8-5-12(9-16(15)22-2)14-10-19-17(20-14)11-3-6-13(18)7-4-11/h3-10H,1-2H3,(H,19,20)
InChI key:InChIKey=GSVDQCPSNBBBGQ-UHFFFAOYSA-N
SMILES:O(C)C=1C=C(C=2NC(=NC2)C3=CC=C(Cl)C=C3)C=CC1OC
Synonyms:- 1H-Imidazole, 2-(4-chlorophenyl)-5-(3,4-dimethoxyphenyl)-
- 2-(4-Chlorophenyl)-5-(3,4-dimethoxyphenyl)-1H-imidazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.