CAS 924859-17-6

2-[2-Methyl-5-(1H-tetrazol-1-yl)phenoxy]acetic acid

Description:

2-[2-Methyl-5-(1H-tetrazol-1-yl)phenoxy]acetic acid is a chemical compound characterized by its unique structure, which includes a phenoxy group and a tetrazole moiety. This compound typically exhibits properties associated with both acidic and aromatic functionalities, making it potentially useful in various chemical applications. The presence of the tetrazole ring contributes to its stability and may enhance its biological activity, as tetrazoles are often found in pharmaceuticals and agrochemicals. The compound's solubility and reactivity can be influenced by the functional groups present, particularly the carboxylic acid group, which can participate in hydrogen bonding and ionic interactions. Additionally, the methyl and phenyl substituents can affect the compound's lipophilicity and overall molecular interactions. While specific physical properties such as melting point, boiling point, and solubility are not provided, compounds of this nature are often studied for their potential roles in medicinal chemistry and as intermediates in organic synthesis.

Formula: C₁₀H₁₀N₄O₃

InChI: InChI=1S/C10H10N4O3/c1-7-2-3-8(14-6-11-12-13-14)4-9(7)17-5-10(15)16/h2-4,6H,5H2,1H3,(H,15,16)

InChI key: InChIKey=ARIXSMFMUNTJAC-UHFFFAOYSA-N

SMILES: O(CC(O)=O)C=1C=C(C=CC1C)N2C=NN=N2

Synonyms:

• 2-[2-Methyl-5-(1H-tetrazol-1-yl)phenoxy]acetic acid
• Acetic acid, 2-[2-methyl-5-(1H-tetrazol-1-yl)phenoxy]-