CymitQuimica logo

CAS 924860-67-3

:

3-[[(4-Methylphenyl)methyl]sulfonyl]-1,2,4-thiadiazol-5-amine

Description:
3-[[(4-Methylphenyl)methyl]sulfonyl]-1,2,4-thiadiazol-5-amine is a chemical compound characterized by its unique structure, which includes a thiadiazole ring and a sulfonamide functional group. The presence of the 4-methylphenyl group contributes to its hydrophobic characteristics, while the sulfonyl group enhances its solubility in polar solvents. This compound typically exhibits properties such as moderate stability under standard conditions, and it may show biological activity, making it of interest in pharmaceutical research. The thiadiazole moiety is known for its potential in various applications, including as a building block in drug development due to its ability to interact with biological targets. Additionally, the compound's molecular structure suggests potential for specific interactions with enzymes or receptors, which could lead to therapeutic effects. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity. Overall, this compound represents a class of sulfonamide derivatives that may have significant implications in medicinal chemistry.
Formula:C10H11N3O2S2
InChI:InChI=1S/C10H11N3O2S2/c1-7-2-4-8(5-3-7)6-17(14,15)10-12-9(11)16-13-10/h2-5H,6H2,1H3,(H2,11,12,13)
InChI key:InChIKey=LNPKVNZXFYBUKH-UHFFFAOYSA-N
SMILES:S(CC1=CC=C(C)C=C1)(=O)(=O)C=2N=C(N)SN2
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.