
CAS 924861-63-2
:2-(1-Piperazinylsulfonyl)ethanamine
Description:
2-(1-Piperazinylsulfonyl)ethanamine, identified by its CAS number 924861-63-2, is a chemical compound characterized by the presence of a piperazine ring and a sulfonamide functional group. This compound typically exhibits properties associated with amines and sulfonamides, such as being polar and potentially soluble in water due to the presence of the sulfonyl group. The piperazine moiety contributes to its biological activity, often making it a subject of interest in medicinal chemistry for its potential pharmacological applications. The sulfonamide group can enhance the compound's ability to interact with biological targets, which may include enzymes or receptors. Additionally, the structure suggests that it may participate in hydrogen bonding, influencing its reactivity and interaction with other molecules. Overall, 2-(1-Piperazinylsulfonyl)ethanamine is notable for its potential therapeutic applications, particularly in the development of drugs targeting various conditions, although specific biological activities would require further investigation.
Formula:C6H15N3O2S
InChI:InChI=1S/C6H15N3O2S/c7-1-6-12(10,11)9-4-2-8-3-5-9/h8H,1-7H2
InChI key:InChIKey=OJIVLWDRYFSBGU-UHFFFAOYSA-N
SMILES:S(CCN)(=O)(=O)N1CCNCC1
Synonyms:- Ethanamine, 2-(1-piperazinylsulfonyl)-
- 2-(1-Piperazinylsulfonyl)ethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.