CymitQuimica logo

CAS 924861-66-5

:

5-[[5-(4-Chlorophenyl)-2H-tetrazol-2-yl]methyl]-1,3,4-thiadiazol-2-amine

Description:
5-[[5-(4-Chlorophenyl)-2H-tetrazol-2-yl]methyl]-1,3,4-thiadiazol-2-amine is a chemical compound characterized by its unique structural features, including a thiadiazole ring and a tetrazole moiety. The presence of a 4-chlorophenyl group enhances its potential biological activity, making it of interest in pharmaceutical research. This compound typically exhibits properties such as moderate solubility in organic solvents and may have specific interactions with biological targets due to its functional groups. The thiadiazole and tetrazole rings contribute to its stability and reactivity, which can be influenced by the substituents on the aromatic ring. Additionally, the compound may demonstrate various biological activities, including antimicrobial or anti-inflammatory effects, although specific biological data would depend on empirical studies. Its CAS number, 924861-66-5, allows for easy identification in chemical databases, facilitating research and development in medicinal chemistry and related fields. Overall, this compound represents a class of heterocyclic compounds with potential applications in drug discovery.
Formula:C10H8ClN7S
InChI:InChI=1S/C10H8ClN7S/c11-7-3-1-6(2-4-7)9-14-17-18(16-9)5-8-13-15-10(12)19-8/h1-4H,5H2,(H2,12,15)
InChI key:InChIKey=CBSSIIDGKFXRCU-UHFFFAOYSA-N
SMILES:C(N1N=C(N=N1)C2=CC=C(Cl)C=C2)C=3SC(N)=NN3
Synonyms:
  • 1,3,4-Thiadiazol-2-amine, 5-[[5-(4-chlorophenyl)-2H-tetrazol-2-yl]methyl]-
  • 5-[[5-(4-Chlorophenyl)-2H-tetrazol-2-yl]methyl]-1,3,4-thiadiazol-2-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.