CAS 924861-72-3

5-[(6,7-Dimethoxy-1,3-benzodioxol-5-yl)methyl]-4,5-dihydro-3-isoxazolecarboxylic acid

Description:

5-[(6,7-Dimethoxy-1,3-benzodioxol-5-yl)methyl]-4,5-dihydro-3-isoxazolecarboxylic acid is a chemical compound characterized by its complex structure, which includes a benzodioxole moiety and an isoxazole ring. This compound features a carboxylic acid functional group, contributing to its potential acidity and reactivity. The presence of methoxy groups on the benzodioxole enhances its electron-donating properties, which can influence its biological activity and solubility. The isoxazole ring is known for its involvement in various pharmacological activities, making this compound of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in areas targeting neurological or inflammatory conditions. The compound's specific interactions, stability, and reactivity would depend on its environment, including pH and solvent conditions. Overall, this substance exemplifies the intricate relationship between molecular structure and biological function, warranting further investigation for its therapeutic potential.

Formula: C₁₄H₁₅NO₇

InChI: InChI=1S/C14H15NO7/c1-18-11-7(3-8-5-9(14(16)17)15-22-8)4-10-12(13(11)19-2)21-6-20-10/h4,8H,3,5-6H2,1-2H3,(H,16,17)

InChI key: InChIKey=LVKLYCODANKYAS-UHFFFAOYSA-N

SMILES: C(C1=C(OC)C(OC)=C2C(=C1)OCO2)C3CC(C(O)=O)=NO3

Synonyms:

• 3-Isoxazolecarboxylic acid, 5-[(6,7-dimethoxy-1,3-benzodioxol-5-yl)methyl]-4,5-dihydro-
• 5-[(6,7-Dimethoxy-1,3-benzodioxol-5-yl)methyl]-4,5-dihydro-3-isoxazolecarboxylic acid