CAS 924861-73-4

Methyl 3-amino-6-bromo-1H-indole-2-carboxylate

Description:

Methyl 3-amino-6-bromo-1H-indole-2-carboxylate is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This specific compound features a bromine atom at the 6-position and an amino group at the 3-position of the indole ring, contributing to its reactivity and potential biological activity. The presence of the carboxylate group, derived from the carboxylic acid, indicates that it can participate in various chemical reactions, such as esterification or amidation. Methyl 3-amino-6-bromo-1H-indole-2-carboxylate is of interest in medicinal chemistry and drug development due to its structural features, which may influence its pharmacological properties. Additionally, the compound's solubility, stability, and reactivity can be influenced by the functional groups present, making it a candidate for further research in synthetic and medicinal applications. As with many indole derivatives, it may exhibit a range of biological activities, including antimicrobial or anticancer properties, warranting further investigation.

Formula: C₁₀H₉BrN₂O₂

InChI: InChI=1S/C10H9BrN2O2/c1-15-10(14)9-8(12)6-3-2-5(11)4-7(6)13-9/h2-4,13H,12H2,1H3

InChI key: InChIKey=ZKVKCBZXUPECEV-UHFFFAOYSA-N

SMILES: NC=1C=2C(NC1C(OC)=O)=CC(Br)=CC2

Synonyms:

• 1H-Indole-2-carboxylic acid, 3-amino-6-bromo-, methyl ester
• Methyl 3-amino-6-bromo-1H-indole-2-carboxylate