
CAS 924861-82-5
:3-(Chloromethyl)-5-[(6,7-dimethoxy-1,3-benzodioxol-5-yl)methyl]-4,5-dihydroisoxazole
Description:
3-(Chloromethyl)-5-[(6,7-dimethoxy-1,3-benzodioxol-5-yl)methyl]-4,5-dihydroisoxazole, with the CAS number 924861-82-5, is a synthetic organic compound characterized by its complex molecular structure, which includes an isoxazole ring and a benzodioxole moiety. The presence of a chloromethyl group suggests potential reactivity, making it a candidate for further chemical modifications or applications in medicinal chemistry. The dimethoxy groups on the benzodioxole contribute to its electronic properties and may enhance its solubility and bioactivity. This compound may exhibit interesting pharmacological properties due to its unique structural features, which could be explored in drug development. Its synthesis and characterization would typically involve standard organic chemistry techniques, including NMR and mass spectrometry for confirmation of structure. As with many compounds in this class, understanding its stability, reactivity, and potential biological activity would be essential for any practical applications.
Formula:C14H16ClNO5
InChI:InChI=1S/C14H16ClNO5/c1-17-12-8(3-10-5-9(6-15)16-21-10)4-11-13(14(12)18-2)20-7-19-11/h4,10H,3,5-7H2,1-2H3
InChI key:InChIKey=WHWZCHQKTJRXDM-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(=CC(CC3CC(CCl)=NO3)=C1OC)OCO2
Synonyms:- 3-(Chloromethyl)-5-[(6,7-dimethoxy-1,3-benzodioxol-5-yl)methyl]-4,5-dihydroisoxazole
- Isoxazole, 3-(chloromethyl)-5-[(6,7-dimethoxy-1,3-benzodioxol-5-yl)methyl]-4,5-dihydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.